C16H15NO2 — CID 14650602
2,6-diphenyl-5,6-dihydro-4H-1,3-oxazin-5-ol (PubChem CID 14650602) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2,6-diphenyl-5,6-dihydro-4H-1,3-oxazin-5-ol.
| Compound Name | 2,6-diphenyl-5,6-dihydro-4H-1,3-oxazin-5-ol |
|---|---|
| PubChem CID | 14650602 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2,6-diphenyl-5,6-dihydro-4H-1,3-oxazin-5-ol |
| SMILES | OC1CN=C(c2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C16H15NO2/c18-14-11-17-16(13-9-5-2-6-10-13)19-15(14)12-7-3-1-4-8-12/h1-10,14-15,18H,11H2 |
| InChIKey | XTSHWUNDJQPOIJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |