C45H39NOS — CID 146506301
N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[4-[4-[3-(2-ethylphenyl)-4-methylsulfanylphenyl]phenoxy]phenyl]ethanimine (PubChem CID 146506301) has the molecular formula C45H39NOS and a molecular weight of 641.88 g/mol. Its IUPAC name is N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[4-[4-[3-(2-ethylphenyl)-4-methylsulfanylphenyl]phenoxy]phenyl]ethanimine.
| Compound Name | N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[4-[4-[3-(2-ethylphenyl)-4-methylsulfanylphenyl]phenoxy]phenyl]ethanimine |
|---|---|
| PubChem CID | 146506301 |
| Molecular Formula | C45H39NOS |
| Molecular Weight | 641.88 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-1-[4-[4-[3-(2-ethylphenyl)-4-methylsulfanylphenyl]phenoxy]phenyl]ethanimine |
| SMILES | C=C(/C=C(\N=C(/C)c1ccc(Oc2ccc(-c3ccc(SC)c(-c4ccccc4CC)c3)cc2)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H39NOS/c1-5-34-14-12-13-19-42(34)43-31-39(24-29-45(43)48-4)37-22-27-41(28-23-37)47-40-25-20-36(21-26-40)33(3)46-44(38-17-10-7-11-18-38)30-32(2)35-15-8-6-9-16-35/h6-31H,2,5H2,1,3-4H3/b44-30-,46-33+ |
| InChIKey | WLVWRPLNRHASLZ-DAQDLILESA-N |
| XLogP | 12.66 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.88 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|