About 1-propyl-3,4-dihydro-2H-1,5-naphthyridine
1-propyl-3,4-dihydro-2H-1,5-naphthyridine (PubChem CID 146506440) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-propyl-3,4-dihydro-2H-1,5-naphthyridine.
Molecular Properties
| Compound Name | 1-propyl-3,4-dihydro-2H-1,5-naphthyridine |
| PubChem CID | 146506440 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-propyl-3,4-dihydro-2H-1,5-naphthyridine |
| SMILES | CCCN1CCCc2ncccc21 |
| InChI | InChI=1S/C11H16N2/c1-2-8-13-9-4-5-10-11(13)6-3-7-12-10/h3,6-7H,2,4-5,8-9H2,1H3 |
| InChIKey | WVKLZYQVAUECKV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-propyl-3,4-dihydro-2H-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-3,4-dihydro-2H-1,5-naphthyridine?
The IUPAC name of 1-propyl-3,4-dihydro-2H-1,5-naphthyridine (CID 146506440) is 1-propyl-3,4-dihydro-2H-1,5-naphthyridine.
What is the SMILES notation for 1-propyl-3,4-dihydro-2H-1,5-naphthyridine?
The canonical SMILES for 1-propyl-3,4-dihydro-2H-1,5-naphthyridine is CCCN1CCCc2ncccc21.
What is the InChIKey of 1-propyl-3,4-dihydro-2H-1,5-naphthyridine?
The InChIKey is WVKLZYQVAUECKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-2-8-13-9-4-5-10-11(13)6-3-7-12-10/h3,6-7H,2,4-5,8-9H2,1H3.
What are the key properties of 1-propyl-3,4-dihydro-2H-1,5-naphthyridine?
1-propyl-3,4-dihydro-2H-1,5-naphthyridine has a molecular weight of 176.26 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-3,4-dihydro-2H-1,5-naphthyridine is sourced from PubChem (CID 146506440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).