About [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate
[2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate (PubChem CID 14650651) has the molecular formula C25H21N3O3
and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate |
| PubChem CID | 14650651 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OC1COC(c2cc3ccccc3[nH]2)=NC1c1ccccc1 |
| InChI | InChI=1S/C25H21N3O3/c29-25(26-19-12-5-2-6-13-19)31-22-16-30-24(28-23(22)17-9-3-1-4-10-17)21-15-18-11-7-8-14-20(18)27-21/h1-15,22-23,27H,16H2,(H,26,29) |
| InChIKey | DCOSHPQCZFZJGV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate?
The IUPAC name of [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate (CID 14650651) is [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate.
What is the SMILES notation for [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate?
The canonical SMILES for [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate is O=C(Nc1ccccc1)OC1COC(c2cc3ccccc3[nH]2)=NC1c1ccccc1.
What is the InChIKey of [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate?
The InChIKey is DCOSHPQCZFZJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O3/c29-25(26-19-12-5-2-6-13-19)31-22-16-30-24(28-23(22)17-9-3-1-4-10-17)21-15-18-11-7-8-14-20(18)27-21/h1-15,22-23,27H,16H2,(H,26,29).
What are the key properties of [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate?
[2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate has a molecular weight of 411.46 g/mol, XLogP of 5.30, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-indol-2-yl)-4-phenyl-5,6-dihydro-4H-1,3-oxazin-5-yl] N-phenylcarbamate is sourced from PubChem (CID 14650651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).