C18H24ClF2N4O8PS — CID 146506728
[(2S,3S,4R,5R)-5-[2-chloro-4-[(4,4-difluorocyclohexyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 146506728) has the molecular formula C18H24ClF2N4O8PS and a molecular weight of 560.90 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[2-chloro-4-[(4,4-difluorocyclohexyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[2-chloro-4-[(4,4-difluorocyclohexyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 146506728 |
| Molecular Formula | C18H24ClF2N4O8PS |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[2-chloro-4-[(4,4-difluorocyclohexyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | O=P(O)(O)CS(=O)(=O)C[C@H]1O[C@@H](n2ccc3c(NC4CCC(F)(F)CC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H24ClF2N4O8PS/c19-17-23-14(22-9-1-4-18(20,21)5-2-9)10-3-6-25(15(10)24-17)16-13(27)12(26)11(33-16)7-35(31,32)8-34(28,29)30/h3,6,9,11-13,16,26-27H,1-2,4-5,7-8H2,(H,22,23,24)(H2,28,29,30)/t11-,12-,13-,16-/m1/s1 |
| InChIKey | RRIZVTUESDYNAB-BRXULGCHSA-N |
| XLogP | 1.24 |
| TPSA | 184.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|