About (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol
(4Z)-2,2-difluorocyclooct-4-ene-1,3-diol (PubChem CID 146507174) has the molecular formula C8H12F2O2
and a molecular weight of 178.18 g/mol. Its IUPAC name is (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol.
Molecular Properties
| Compound Name | (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol |
| PubChem CID | 146507174 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol |
| SMILES | OC1/C=C\CCCC(O)C1(F)F |
| InChI | InChI=1S/C8H12F2O2/c9-8(10)6(11)4-2-1-3-5-7(8)12/h2,4,6-7,11-12H,1,3,5H2/b4-2- |
| InChIKey | UHEMRWPQVWNVTP-RQOWECAXSA-N |
| XLogP | 1.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol?
The IUPAC name of (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol (CID 146507174) is (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol.
What is the SMILES notation for (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol?
The canonical SMILES for (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol is OC1/C=C\CCCC(O)C1(F)F.
What is the InChIKey of (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol?
The InChIKey is UHEMRWPQVWNVTP-RQOWECAXSA-N. The full InChI is InChI=1S/C8H12F2O2/c9-8(10)6(11)4-2-1-3-5-7(8)12/h2,4,6-7,11-12H,1,3,5H2/b4-2-.
What are the key properties of (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol?
(4Z)-2,2-difluorocyclooct-4-ene-1,3-diol has a molecular weight of 178.18 g/mol, XLogP of 1.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2,2-difluorocyclooct-4-ene-1,3-diol is sourced from PubChem (CID 146507174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).