About 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol
3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol (PubChem CID 146507702) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol.
Molecular Properties
| Compound Name | 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol |
| PubChem CID | 146507702 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol |
| SMILES | Cc1cc(C)c(N(CCCCO)c2cccc(O)c2)c(C)c1 |
| InChI | InChI=1S/C19H25NO2/c1-14-11-15(2)19(16(3)12-14)20(9-4-5-10-21)17-7-6-8-18(22)13-17/h6-8,11-13,21-22H,4-5,9-10H2,1-3H3 |
| InChIKey | UWMSTAARANWLIS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol?
The IUPAC name of 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol (CID 146507702) is 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol.
What is the SMILES notation for 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol?
The canonical SMILES for 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol is Cc1cc(C)c(N(CCCCO)c2cccc(O)c2)c(C)c1.
What is the InChIKey of 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol?
The InChIKey is UWMSTAARANWLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO2/c1-14-11-15(2)19(16(3)12-14)20(9-4-5-10-21)17-7-6-8-18(22)13-17/h6-8,11-13,21-22H,4-5,9-10H2,1-3H3.
What are the key properties of 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol?
3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol has a molecular weight of 299.41 g/mol, XLogP of 4.23, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[N-(4-hydroxybutyl)-2,4,6-trimethylanilino]phenol is sourced from PubChem (CID 146507702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).