About 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide
3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide (PubChem CID 146507952) has the molecular formula C16H10F2N4O4
and a molecular weight of 360.28 g/mol. Its IUPAC name is 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide.
Molecular Properties
| Compound Name | 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide |
| PubChem CID | 146507952 |
| Molecular Formula | C16H10F2N4O4 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide |
| SMILES | N#Cc1ccc(O)c(C(=O)N=C(N)N)c1-c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C16H10F2N4O4/c17-16(18)25-10-3-1-2-8(13(10)26-16)11-7(6-19)4-5-9(23)12(11)14(24)22-15(20)21/h1-5,23H,(H4,20,21,22,24) |
| InChIKey | KESGCPLRDUYPBH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 143.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide?
The IUPAC name of 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide (CID 146507952) is 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide.
What is the SMILES notation for 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide?
The canonical SMILES for 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide is N#Cc1ccc(O)c(C(=O)N=C(N)N)c1-c1cccc2c1OC(F)(F)O2.
What is the InChIKey of 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide?
The InChIKey is KESGCPLRDUYPBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N4O4/c17-16(18)25-10-3-1-2-8(13(10)26-16)11-7(6-19)4-5-9(23)12(11)14(24)22-15(20)21/h1-5,23H,(H4,20,21,22,24).
What are the key properties of 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide?
3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide has a molecular weight of 360.28 g/mol, XLogP of 1.67, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxybenzamide is sourced from PubChem (CID 146507952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).