About 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide
3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide (PubChem CID 146507958) has the molecular formula C17H13FN4O2
and a molecular weight of 324.32 g/mol. Its IUPAC name is 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide.
Molecular Properties
| Compound Name | 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide |
| PubChem CID | 146507958 |
| Molecular Formula | C17H13FN4O2 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide |
| SMILES | N#Cc1ccc(O)c(C(=O)NC2=NCCN2)c1-c1ccccc1F |
| InChI | InChI=1S/C17H13FN4O2/c18-12-4-2-1-3-11(12)14-10(9-19)5-6-13(23)15(14)16(24)22-17-20-7-8-21-17/h1-6,23H,7-8H2,(H2,20,21,22,24) |
| InChIKey | LVRHNVLHDNRHAC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide?
The IUPAC name of 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide (CID 146507958) is 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide.
What is the SMILES notation for 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide?
The canonical SMILES for 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide is N#Cc1ccc(O)c(C(=O)NC2=NCCN2)c1-c1ccccc1F.
What is the InChIKey of 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide?
The InChIKey is LVRHNVLHDNRHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN4O2/c18-12-4-2-1-3-11(12)14-10(9-19)5-6-13(23)15(14)16(24)22-17-20-7-8-21-17/h1-6,23H,7-8H2,(H2,20,21,22,24).
What are the key properties of 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide?
3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide has a molecular weight of 324.32 g/mol, XLogP of 1.76, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluorophenyl)-6-hydroxybenzamide is sourced from PubChem (CID 146507958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).