About 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide
3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide (PubChem CID 146507965) has the molecular formula C18H15FN4O2
and a molecular weight of 338.34 g/mol. Its IUPAC name is 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide.
Molecular Properties
| Compound Name | 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide |
| PubChem CID | 146507965 |
| Molecular Formula | C18H15FN4O2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide |
| SMILES | Cc1cc(F)cc(-c2c(C#N)ccc(O)c2C(=O)NC2=NCCN2)c1 |
| InChI | InChI=1S/C18H15FN4O2/c1-10-6-12(8-13(19)7-10)15-11(9-20)2-3-14(24)16(15)17(25)23-18-21-4-5-22-18/h2-3,6-8,24H,4-5H2,1H3,(H2,21,22,23,25) |
| InChIKey | VLKXIMSKQMMLMP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide?
The IUPAC name of 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide (CID 146507965) is 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide.
What is the SMILES notation for 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide?
The canonical SMILES for 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide is Cc1cc(F)cc(-c2c(C#N)ccc(O)c2C(=O)NC2=NCCN2)c1.
What is the InChIKey of 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide?
The InChIKey is VLKXIMSKQMMLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN4O2/c1-10-6-12(8-13(19)7-10)15-11(9-20)2-3-14(24)16(15)17(25)23-18-21-4-5-22-18/h2-3,6-8,24H,4-5H2,1H3,(H2,21,22,23,25).
What are the key properties of 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide?
3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide has a molecular weight of 338.34 g/mol, XLogP of 2.07, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(3-fluoro-5-methylphenyl)-6-hydroxybenzamide is sourced from PubChem (CID 146507965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).