C12H11F3N4O2 — CID 146507973
5-cyano-2-hydroxy-N-[N'-(3,3,3-trifluoropropyl)carbamimidoyl]benzamide (PubChem CID 146507973) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is 5-cyano-2-hydroxy-N-[N'-(3,3,3-trifluoropropyl)carbamimidoyl]benzamide.
| Compound Name | 5-cyano-2-hydroxy-N-[N'-(3,3,3-trifluoropropyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 146507973 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 5-cyano-2-hydroxy-N-[N'-(3,3,3-trifluoropropyl)carbamimidoyl]benzamide |
| SMILES | N#Cc1ccc(O)c(C(=O)N/C(N)=N/CCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3N4O2/c13-12(14,15)3-4-18-11(17)19-10(21)8-5-7(6-16)1-2-9(8)20/h1-2,5,20H,3-4H2,(H3,17,18,19,21) |
| InChIKey | KMGGUYIUCKHYPX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|