About 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide
5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide (PubChem CID 146507980) has the molecular formula C13H16N4O3
and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide.
Molecular Properties
| Compound Name | 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide |
| PubChem CID | 146507980 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide |
| SMILES | CCOCC/N=C(\N)NC(=O)c1cc(C#N)ccc1O |
| InChI | InChI=1S/C13H16N4O3/c1-2-20-6-5-16-13(15)17-12(19)10-7-9(8-14)3-4-11(10)18/h3-4,7,18H,2,5-6H2,1H3,(H3,15,16,17,19) |
| InChIKey | XLEMVJQTXCUMHG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 120.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide?
The IUPAC name of 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide (CID 146507980) is 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide.
What is the SMILES notation for 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide?
The canonical SMILES for 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide is CCOCC/N=C(\N)NC(=O)c1cc(C#N)ccc1O.
What is the InChIKey of 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide?
The InChIKey is XLEMVJQTXCUMHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O3/c1-2-20-6-5-16-13(15)17-12(19)10-7-9(8-14)3-4-11(10)18/h3-4,7,18H,2,5-6H2,1H3,(H3,15,16,17,19).
What are the key properties of 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide?
5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide has a molecular weight of 276.30 g/mol, XLogP of 0.34, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-N-[N'-(2-ethoxyethyl)carbamimidoyl]-2-hydroxybenzamide is sourced from PubChem (CID 146507980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).