About 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide
3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide (PubChem CID 146508021) has the molecular formula C17H15FN4O2
and a molecular weight of 326.33 g/mol. Its IUPAC name is 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide.
Molecular Properties
| Compound Name | 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide |
| PubChem CID | 146508021 |
| Molecular Formula | C17H15FN4O2 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide |
| SMILES | N#Cc1ccc(O)c(C(=O)N/C(N)=N/CCF)c1-c1ccccc1 |
| InChI | InChI=1S/C17H15FN4O2/c18-8-9-21-17(20)22-16(24)15-13(23)7-6-12(10-19)14(15)11-4-2-1-3-5-11/h1-7,23H,8-9H2,(H3,20,21,22,24) |
| InChIKey | RCKAKBOMDQYBDN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide?
The IUPAC name of 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide (CID 146508021) is 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide.
What is the SMILES notation for 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide?
The canonical SMILES for 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide is N#Cc1ccc(O)c(C(=O)N/C(N)=N/CCF)c1-c1ccccc1.
What is the InChIKey of 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide?
The InChIKey is RCKAKBOMDQYBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN4O2/c18-8-9-21-17(20)22-16(24)15-13(23)7-6-12(10-19)14(15)11-4-2-1-3-5-11/h1-7,23H,8-9H2,(H3,20,21,22,24).
What are the key properties of 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide?
3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide has a molecular weight of 326.33 g/mol, XLogP of 1.94, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-[N'-(2-fluoroethyl)carbamimidoyl]-6-hydroxy-2-phenylbenzamide is sourced from PubChem (CID 146508021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).