C29H23F4N7O3 — CID 146508331
4-[3-[(2S,3aR,6aS)-1-but-2-ynoyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 146508331) has the molecular formula C29H23F4N7O3 and a molecular weight of 593.54 g/mol. Its IUPAC name is 4-[3-[(2S,3aR,6aS)-1-but-2-ynoyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[3-[(2S,3aR,6aS)-1-but-2-ynoyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 146508331 |
| Molecular Formula | C29H23F4N7O3 |
| Molecular Weight | 593.54 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | 4-[3-[(2S,3aR,6aS)-1-but-2-ynoyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CC#CC(=O)N1[C@@H]2COC[C@@H]2C[C@H]1c1nc(-c2ccc(C(=O)Nc3cc(C(F)(F)F)ccn3)cc2F)c2c(N)nccn12 |
| InChI | InChI=1S/C29H23F4N7O3/c1-2-3-23(41)40-20(11-16-13-43-14-21(16)40)27-38-24(25-26(34)36-8-9-39(25)27)18-5-4-15(10-19(18)30)28(42)37-22-12-17(6-7-35-22)29(31,32)33/h4-10,12,16,20-21H,11,13-14H2,1H3,(H2,34,36)(H,35,37,42)/t16-,20-,21+/m0/s1 |
| InChIKey | JVHLNDBZJBEUGS-ORYQWCPZSA-N |
| XLogP | 4.10 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|