About (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine
(1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine (PubChem CID 146510508) has the molecular formula C9H17F2NS
and a molecular weight of 209.30 g/mol. Its IUPAC name is (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine.
Molecular Properties
| Compound Name | (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine |
| PubChem CID | 146510508 |
| Molecular Formula | C9H17F2NS |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine |
| SMILES | CSC1(C(C)C)CCC(F)(F)[C@H]1N |
| InChI | InChI=1S/C9H17F2NS/c1-6(2)8(13-3)4-5-9(10,11)7(8)12/h6-7H,4-5,12H2,1-3H3/t7-,8?/m0/s1 |
| InChIKey | GTTBEGYVEINCCT-JAMMHHFISA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine?
The IUPAC name of (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine (CID 146510508) is (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine.
What is the SMILES notation for (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine?
The canonical SMILES for (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine is CSC1(C(C)C)CCC(F)(F)[C@H]1N.
What is the InChIKey of (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine?
The InChIKey is GTTBEGYVEINCCT-JAMMHHFISA-N. The full InChI is InChI=1S/C9H17F2NS/c1-6(2)8(13-3)4-5-9(10,11)7(8)12/h6-7H,4-5,12H2,1-3H3/t7-,8?/m0/s1.
What are the key properties of (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine?
(1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine has a molecular weight of 209.30 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2-difluoro-5-methylsulfanyl-5-propan-2-ylcyclopentan-1-amine is sourced from PubChem (CID 146510508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).