C17H24ClFN2 — CID 146510619
(2S,4S)-4-[(2Z,4Z,6E)-7-chloro-2-fluorohepta-2,4,6-trien-3-yl]-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile (PubChem CID 146510619) has the molecular formula C17H24ClFN2 and a molecular weight of 310.84 g/mol. Its IUPAC name is (2S,4S)-4-[(2Z,4Z,6E)-7-chloro-2-fluorohepta-2,4,6-trien-3-yl]-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile.
| Compound Name | (2S,4S)-4-[(2Z,4Z,6E)-7-chloro-2-fluorohepta-2,4,6-trien-3-yl]-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 146510619 |
| Molecular Formula | C17H24ClFN2 |
| Molecular Weight | 310.84 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (2S,4S)-4-[(2Z,4Z,6E)-7-chloro-2-fluorohepta-2,4,6-trien-3-yl]-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile |
| SMILES | C/C(F)=C(\C=C/C=C/Cl)[C@H]1CN[C@@H](CC(C)(C)C)C1C#N |
| InChI | InChI=1S/C17H24ClFN2/c1-12(19)13(7-5-6-8-18)15-11-21-16(14(15)10-20)9-17(2,3)4/h5-8,14-16,21H,9,11H2,1-4H3/b7-5-,8-6+,13-12-/t14?,15-,16+/m1/s1 |
| InChIKey | WRCHPKHQRQNMBZ-UIRFUJNLSA-N |
| XLogP | 4.70 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|