C17H18ClN4O8P — CID 146511253
1-[(2R,4R)-5-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxy-3-oxooxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 146511253) has the molecular formula C17H18ClN4O8P and a molecular weight of 472.78 g/mol. Its IUPAC name is 1-[(2R,4R)-5-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxy-3-oxooxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(2R,4R)-5-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxy-3-oxooxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 146511253 |
| Molecular Formula | C17H18ClN4O8P |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 1-[(2R,4R)-5-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxy-3-oxooxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn([C@@H]2OC(COP3(=O)OCC[C@@H](c4cccc(Cl)c4)O3)[C@@H](O)C2=O)n1 |
| InChI | InChI=1S/C17H18ClN4O8P/c18-10-3-1-2-9(6-10)11-4-5-27-31(26,30-11)28-7-12-13(23)14(24)17(29-12)22-8-20-16(21-22)15(19)25/h1-3,6,8,11-13,17,23H,4-5,7H2,(H2,19,25)/t11-,12?,13+,17+,31?/m0/s1 |
| InChIKey | OZSIOSZYQXQJLD-MPKMAFFWSA-N |
| XLogP | 1.16 |
| TPSA | 165.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|