C8H12N4O5P+ — CID 146511897
[(2S,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)oxolan-2-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 146511897) has the molecular formula C8H12N4O5P+ and a molecular weight of 275.18 g/mol. Its IUPAC name is [(2S,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)oxolan-2-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [(2S,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 146511897 |
| Molecular Formula | C8H12N4O5P+ |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | [(2S,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | NC(=O)c1ncn([C@H]2CC[C@@H](CO[P+](=O)O)O2)n1 |
| InChI | InChI=1S/C8H11N4O5P/c9-7(13)8-10-4-12(11-8)6-2-1-5(17-6)3-16-18(14)15/h4-6H,1-3H2,(H2-,9,13,14,15)/p+1/t5-,6+/m0/s1 |
| InChIKey | GWHDHRICLQLFPE-NTSWFWBYSA-O |
| XLogP | -0.28 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|