C8H12N4O5PS+ — CID 146511899
[(2S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]methoxy-oxo-sulfanylphosphanium (PubChem CID 146511899) has the molecular formula C8H12N4O5PS+ and a molecular weight of 307.25 g/mol. Its IUPAC name is [(2S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]methoxy-oxo-sulfanylphosphanium.
| Compound Name | [(2S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]methoxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 146511899 |
| Molecular Formula | C8H12N4O5PS+ |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | [(2S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]methoxy-oxo-sulfanylphosphanium |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](CO[P+](=O)S)C[C@H]2O)n1 |
| InChI | InChI=1S/C8H11N4O5PS/c9-6(14)7-10-3-12(11-7)8-5(13)1-4(17-8)2-16-18(15)19/h3-5,8,13H,1-2H2,(H2-,9,14,15,19)/p+1/t4-,5+,8+/m0/s1 |
| InChIKey | RMXBRUBGAHBQEV-CPDSJTNBSA-O |
| XLogP | -0.37 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|