C7H11N3O2S — CID 146511972
3-cyclopropyl-5-methyl-1-methylsulfonyl-1,2,4-triazole (PubChem CID 146511972) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-cyclopropyl-5-methyl-1-methylsulfonyl-1,2,4-triazole.
| Compound Name | 3-cyclopropyl-5-methyl-1-methylsulfonyl-1,2,4-triazole |
|---|---|
| PubChem CID | 146511972 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-cyclopropyl-5-methyl-1-methylsulfonyl-1,2,4-triazole |
| SMILES | Cc1nc(C2CC2)nn1S(C)(=O)=O |
| InChI | InChI=1S/C7H11N3O2S/c1-5-8-7(6-3-4-6)9-10(5)13(2,11)12/h6H,3-4H2,1-2H3 |
| InChIKey | ZBQWBGGMYFVSDH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |