C15H24N2O5 — CID 146513220
[(E)-2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]ethenyl] prop-2-enoate (PubChem CID 146513220) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is [(E)-2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]ethenyl] prop-2-enoate.
| Compound Name | [(E)-2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]ethenyl] prop-2-enoate |
|---|---|
| PubChem CID | 146513220 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [(E)-2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]ethenyl] prop-2-enoate |
| SMILES | C=CC(=O)O/C=C/NC(=O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C15H24N2O5/c1-6-12(18)21-8-7-16-13(19)22-11-9-14(2,3)17(20)15(4,5)10-11/h6-8,11,20H,1,9-10H2,2-5H3,(H,16,19)/b8-7+ |
| InChIKey | GABIFAKQPMASBR-BQYQJAHWSA-N |
| XLogP | 2.32 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|