About 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine
2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine (PubChem CID 146513712) has the molecular formula C14H20F3N3O
and a molecular weight of 303.33 g/mol. Its IUPAC name is 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine.
Molecular Properties
| Compound Name | 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine |
| PubChem CID | 146513712 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine |
| SMILES | CCC(Oc1cnc(C(F)(F)F)cn1)C1CC(C)CN1C |
| InChI | InChI=1S/C14H20F3N3O/c1-4-11(10-5-9(2)8-20(10)3)21-13-7-18-12(6-19-13)14(15,16)17/h6-7,9-11H,4-5,8H2,1-3H3 |
| InChIKey | GRZUMZXEVLVECM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine?
The IUPAC name of 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine (CID 146513712) is 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine.
What is the SMILES notation for 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine?
The canonical SMILES for 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine is CCC(Oc1cnc(C(F)(F)F)cn1)C1CC(C)CN1C.
What is the InChIKey of 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine?
The InChIKey is GRZUMZXEVLVECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F3N3O/c1-4-11(10-5-9(2)8-20(10)3)21-13-7-18-12(6-19-13)14(15,16)17/h6-7,9-11H,4-5,8H2,1-3H3.
What are the key properties of 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine?
2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine has a molecular weight of 303.33 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1,4-dimethylpyrrolidin-2-yl)propoxy]-5-(trifluoromethyl)pyrazine is sourced from PubChem (CID 146513712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).