C15H25F — CID 146513919
7-fluoro-1,6,6,7-tetramethyl-2,3,3a,3b,4,5,6a,7a-octahydro-1H-cyclopenta[a]pentalene (PubChem CID 146513919) has the molecular formula C15H25F and a molecular weight of 224.36 g/mol. Its IUPAC name is 7-fluoro-1,6,6,7-tetramethyl-2,3,3a,3b,4,5,6a,7a-octahydro-1H-cyclopenta[a]pentalene.
| Compound Name | 7-fluoro-1,6,6,7-tetramethyl-2,3,3a,3b,4,5,6a,7a-octahydro-1H-cyclopenta[a]pentalene |
|---|---|
| PubChem CID | 146513919 |
| Molecular Formula | C15H25F |
| Molecular Weight | 224.36 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 7-fluoro-1,6,6,7-tetramethyl-2,3,3a,3b,4,5,6a,7a-octahydro-1H-cyclopenta[a]pentalene |
| SMILES | CC1CCC2C3CCC(C)(C)C3C(C)(F)C12 |
| InChI | InChI=1S/C15H25F/c1-9-5-6-10-11-7-8-14(2,3)13(11)15(4,16)12(9)10/h9-13H,5-8H2,1-4H3 |
| InChIKey | OYIGJERMAGBVAB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |