About 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile
4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile (PubChem CID 146514101) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile |
| PubChem CID | 146514101 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile |
| SMILES | CN1C2CCC1CN(c1ccc(C#N)cc1)C2 |
| InChI | InChI=1S/C14H17N3/c1-16-13-6-7-14(16)10-17(9-13)12-4-2-11(8-15)3-5-12/h2-5,13-14H,6-7,9-10H2,1H3 |
| InChIKey | PEOYINPEYOHIGR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile?
The IUPAC name of 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile (CID 146514101) is 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile.
What is the SMILES notation for 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile?
The canonical SMILES for 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile is CN1C2CCC1CN(c1ccc(C#N)cc1)C2.
What is the InChIKey of 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile?
The InChIKey is PEOYINPEYOHIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3/c1-16-13-6-7-14(16)10-17(9-13)12-4-2-11(8-15)3-5-12/h2-5,13-14H,6-7,9-10H2,1H3.
What are the key properties of 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile?
4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile has a molecular weight of 227.31 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)benzonitrile is sourced from PubChem (CID 146514101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).