C17H20INO4 — CID 14651441
methyl (1R,2R,3S,5S)-3-(2-iodobenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 14651441) has the molecular formula C17H20INO4 and a molecular weight of 429.25 g/mol. Its IUPAC name is methyl (1R,2R,3S,5S)-3-(2-iodobenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2R,3S,5S)-3-(2-iodobenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 14651441 |
| Molecular Formula | C17H20INO4 |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | methyl (1R,2R,3S,5S)-3-(2-iodobenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](OC(=O)c2ccccc2I)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C17H20INO4/c1-19-10-7-8-13(19)15(17(21)22-2)14(9-10)23-16(20)11-5-3-4-6-12(11)18/h3-6,10,13-15H,7-9H2,1-2H3/t10-,13+,14-,15+/m0/s1 |
| InChIKey | AWVUKTXSKOZAJP-OADPDTJPSA-N |
| XLogP | 2.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|