C26H45N5 — CID 146514435
(3E,6Z)-6-[4-[[[(Z)-hex-4-en-3-yl]amino]methyl]-1,2,4-triazol-3-yl]-N,N-dimethyl-3-pent-2-enyldeca-3,6-dien-1-amine (PubChem CID 146514435) has the molecular formula C26H45N5 and a molecular weight of 427.68 g/mol. Its IUPAC name is (3E,6Z)-6-[4-[[[(Z)-hex-4-en-3-yl]amino]methyl]-1,2,4-triazol-3-yl]-N,N-dimethyl-3-pent-2-enyldeca-3,6-dien-1-amine.
| Compound Name | (3E,6Z)-6-[4-[[[(Z)-hex-4-en-3-yl]amino]methyl]-1,2,4-triazol-3-yl]-N,N-dimethyl-3-pent-2-enyldeca-3,6-dien-1-amine |
|---|---|
| PubChem CID | 146514435 |
| Molecular Formula | C26H45N5 |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 427.37 |
| IUPAC Name | (3E,6Z)-6-[4-[[[(Z)-hex-4-en-3-yl]amino]methyl]-1,2,4-triazol-3-yl]-N,N-dimethyl-3-pent-2-enyldeca-3,6-dien-1-amine |
| SMILES | C/C=C\C(CC)NCn1cnnc1/C(=C\CCC)C/C=C(\CC=CCC)CCN(C)C |
| InChI | InChI=1S/C26H45N5/c1-7-11-13-15-23(19-20-30(5)6)17-18-24(16-12-8-2)26-29-28-22-31(26)21-27-25(10-4)14-9-3/h9,11,13-14,16-17,22,25,27H,7-8,10,12,15,18-21H2,1-6H3/b13-11?,14-9-,23-17+,24-16- |
| InChIKey | SZYBHOUZSBKHCU-VFLLUMJUSA-N |
| XLogP | 5.99 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|