C30H44O5 — CID 146514634
[(11R,13R)-11-butanoyloxy-3,10,10,11,13-pentamethyl-14-oxo-7-tricyclo[7.4.1.01,5]tetradeca-2,7-dienyl]methyl 2,3-dimethylbut-2-enoate (PubChem CID 146514634) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is [(11R,13R)-11-butanoyloxy-3,10,10,11,13-pentamethyl-14-oxo-7-tricyclo[7.4.1.01,5]tetradeca-2,7-dienyl]methyl 2,3-dimethylbut-2-enoate.
| Compound Name | [(11R,13R)-11-butanoyloxy-3,10,10,11,13-pentamethyl-14-oxo-7-tricyclo[7.4.1.01,5]tetradeca-2,7-dienyl]methyl 2,3-dimethylbut-2-enoate |
|---|---|
| PubChem CID | 146514634 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | [(11R,13R)-11-butanoyloxy-3,10,10,11,13-pentamethyl-14-oxo-7-tricyclo[7.4.1.01,5]tetradeca-2,7-dienyl]methyl 2,3-dimethylbut-2-enoate |
| SMILES | CCCC(=O)O[C@]1(C)C[C@@H](C)C23C=C(C)CC2CC(COC(=O)C(C)=C(C)C)=CC(C3=O)C1(C)C |
| InChI | InChI=1S/C30H44O5/c1-10-11-25(31)35-29(9)16-20(5)30-15-19(4)12-23(30)13-22(14-24(26(30)32)28(29,7)8)17-34-27(33)21(6)18(2)3/h14-15,20,23-24H,10-13,16-17H2,1-9H3/t20-,23?,24?,29-,30?/m1/s1 |
| InChIKey | BVSNSVOEKWTFBO-HEZAPMGCSA-N |
| XLogP | 6.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|