C25H34O7 — CID 146514914
[(1S,4S,5R,6R,9S,10R,12S,14R)-4,5,6,12-tetrahydroxy-3,11,11,14-tetramethyl-15-oxo-7-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl]methyl (E)-2-methylbut-2-enoate (PubChem CID 146514914) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is [(1S,4S,5R,6R,9S,10R,12S,14R)-4,5,6,12-tetrahydroxy-3,11,11,14-tetramethyl-15-oxo-7-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [(1S,4S,5R,6R,9S,10R,12S,14R)-4,5,6,12-tetrahydroxy-3,11,11,14-tetramethyl-15-oxo-7-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 146514914 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [(1S,4S,5R,6R,9S,10R,12S,14R)-4,5,6,12-tetrahydroxy-3,11,11,14-tetramethyl-15-oxo-7-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OCC1=C[C@@H]2C(=O)[C@]3(C=C(C)[C@H](O)[C@@]3(O)[C@@H]1O)[C@H](C)C[C@]1(O)[C@H]2C1(C)C |
| InChI | InChI=1S/C25H34O7/c1-7-12(2)21(29)32-11-15-8-16-17-22(5,6)24(17,30)10-14(4)23(20(16)28)9-13(3)18(26)25(23,31)19(15)27/h7-9,14,16-19,26-27,30-31H,10-11H2,1-6H3/b12-7+/t14-,16+,17-,18+,19-,23+,24+,25-/m1/s1 |
| InChIKey | CVVBFZPNEUHQEB-SFBXYDRSSA-N |
| XLogP | 1.45 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|