C6H11N3O2S2 — CID 146515041
2-[2-(aminosulfonimidoyl)-1,3-thiazol-4-yl]propan-2-ol (PubChem CID 146515041) has the molecular formula C6H11N3O2S2 and a molecular weight of 221.31 g/mol. Its IUPAC name is 2-[2-(aminosulfonimidoyl)-1,3-thiazol-4-yl]propan-2-ol.
| Compound Name | 2-[2-(aminosulfonimidoyl)-1,3-thiazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 146515041 |
| Molecular Formula | C6H11N3O2S2 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2-[2-(aminosulfonimidoyl)-1,3-thiazol-4-yl]propan-2-ol |
| SMILES | [H]N=S(N)(=O)c1nc(C(C)(C)O)cs1 |
| InChI | InChI=1S/C6H11N3O2S2/c1-6(2,10)4-3-12-5(9-4)13(7,8)11/h3,10H,1-2H3,(H3,7,8,11) |
| InChIKey | WVQYRXBNUKIXEK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |