C19H14F8N4O2S — CID 146516943
3-ethylsulfonyl-5-(3-fluoro-2-pyridinyl)-2-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylimidazol-2-yl]pyridine (PubChem CID 146516943) has the molecular formula C19H14F8N4O2S and a molecular weight of 514.40 g/mol. Its IUPAC name is 3-ethylsulfonyl-5-(3-fluoro-2-pyridinyl)-2-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylimidazol-2-yl]pyridine.
| Compound Name | 3-ethylsulfonyl-5-(3-fluoro-2-pyridinyl)-2-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylimidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 146516943 |
| Molecular Formula | C19H14F8N4O2S |
| Molecular Weight | 514.40 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 3-ethylsulfonyl-5-(3-fluoro-2-pyridinyl)-2-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylimidazol-2-yl]pyridine |
| SMILES | CCS(=O)(=O)c1cc(-c2ncccc2F)cnc1-c1ncc(C(F)(F)C(F)(F)C(F)(F)F)n1C |
| InChI | InChI=1S/C19H14F8N4O2S/c1-3-34(32,33)12-7-10(14-11(20)5-4-6-28-14)8-29-15(12)16-30-9-13(31(16)2)17(21,22)18(23,24)19(25,26)27/h4-9H,3H2,1-2H3 |
| InChIKey | UCNKSTUGCSXZCP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|