About 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one
3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 146517083) has the molecular formula C6H4IN3O
and a molecular weight of 261.02 g/mol. Its IUPAC name is 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one.
Molecular Properties
| Compound Name | 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one |
| PubChem CID | 146517083 |
| Molecular Formula | C6H4IN3O |
| Molecular Weight | 261.02 g/mol |
| Exact Mass | 260.94 |
| IUPAC Name | 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | O=c1c2cccn2ncn1I |
| InChI | InChI=1S/C6H4IN3O/c7-9-4-8-10-3-1-2-5(10)6(9)11/h1-4H |
| InChIKey | YXNMOXJRNLCLRZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.02 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one?
The IUPAC name of 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one (CID 146517083) is 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one.
What is the SMILES notation for 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one?
The canonical SMILES for 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one is O=c1c2cccn2ncn1I.
What is the InChIKey of 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one?
The InChIKey is YXNMOXJRNLCLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4IN3O/c7-9-4-8-10-3-1-2-5(10)6(9)11/h1-4H.
What are the key properties of 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one?
3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one has a molecular weight of 261.02 g/mol, XLogP of 0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodopyrrolo[2,1-f][1,2,4]triazin-4-one is sourced from PubChem (CID 146517083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).