C86H68N2O4 — CID 146517121
N-[4-[4-(N-[9,9-bis(4-prop-2-enoxyphenyl)fluoren-2-yl]anilino)phenyl]phenyl]-N-phenyl-9,9-bis(4-prop-2-enoxyphenyl)fluoren-2-amine (PubChem CID 146517121) has the molecular formula C86H68N2O4 and a molecular weight of 1193.50 g/mol. Its IUPAC name is N-[4-[4-(N-[9,9-bis(4-prop-2-enoxyphenyl)fluoren-2-yl]anilino)phenyl]phenyl]-N-phenyl-9,9-bis(4-prop-2-enoxyphenyl)fluoren-2-amine.
| Compound Name | N-[4-[4-(N-[9,9-bis(4-prop-2-enoxyphenyl)fluoren-2-yl]anilino)phenyl]phenyl]-N-phenyl-9,9-bis(4-prop-2-enoxyphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 146517121 |
| Molecular Formula | C86H68N2O4 |
| Molecular Weight | 1193.50 g/mol |
| Exact Mass | 1192.52 |
| IUPAC Name | N-[4-[4-(N-[9,9-bis(4-prop-2-enoxyphenyl)fluoren-2-yl]anilino)phenyl]phenyl]-N-phenyl-9,9-bis(4-prop-2-enoxyphenyl)fluoren-2-amine |
| SMILES | C=CCOc1ccc(C2(c3ccc(OCC=C)cc3)c3ccccc3-c3ccc(N(c4ccccc4)c4ccc(-c5ccc(N(c6ccccc6)c6ccc7c(c6)C(c6ccc(OCC=C)cc6)(c6ccc(OCC=C)cc6)c6ccccc6-7)cc5)cc4)cc32)cc1 |
| InChI | InChI=1S/C86H68N2O4/c1-5-55-89-73-45-31-63(32-46-73)85(64-33-47-74(48-34-64)90-56-6-2)81-25-17-15-23-77(81)79-53-43-71(59-83(79)85)87(67-19-11-9-12-20-67)69-39-27-61(28-40-69)62-29-41-70(42-30-62)88(68-21-13-10-14-22-68)72-44-54-80-78-24-16-18-26-82(78)86(84(80)60-72,65-35-49-75(50-36-65)91-57-7-3)66-37-51-76(52-38-66)92-58-8-4/h5-54,59-60H,1-4,55-58H2 |
| InChIKey | GTLKCWLWOUKFQT-UHFFFAOYSA-N |
| XLogP | 21.28 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1193.50 |
| LogP ≤ 5 | 21.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|