About 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal
3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal (PubChem CID 146517460) has the molecular formula C13H23F2NO2
and a molecular weight of 263.33 g/mol. Its IUPAC name is 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal.
Molecular Properties
| Compound Name | 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal |
| PubChem CID | 146517460 |
| Molecular Formula | C13H23F2NO2 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal |
| SMILES | CC(F)(F)C(COCCC=O)CC1CCCCN1 |
| InChI | InChI=1S/C13H23F2NO2/c1-13(14,15)11(10-18-8-4-7-17)9-12-5-2-3-6-16-12/h7,11-12,16H,2-6,8-10H2,1H3 |
| InChIKey | WWKFYYBEYXDPJQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal?
The IUPAC name of 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal (CID 146517460) is 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal.
What is the SMILES notation for 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal?
The canonical SMILES for 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal is CC(F)(F)C(COCCC=O)CC1CCCCN1.
What is the InChIKey of 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal?
The InChIKey is WWKFYYBEYXDPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F2NO2/c1-13(14,15)11(10-18-8-4-7-17)9-12-5-2-3-6-16-12/h7,11-12,16H,2-6,8-10H2,1H3.
What are the key properties of 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal?
3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal has a molecular weight of 263.33 g/mol, XLogP of 2.40, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-difluoro-2-(piperidin-2-ylmethyl)butoxy]propanal is sourced from PubChem (CID 146517460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).