4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid

C10H16F2N2O2 — CID 146517489

IUPAC4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid
SMILESO=C(O)C1CC(N2CCC(F)(F)CC2)CN1
InChIInChI=1S/C10H16F2N2O2/c11-10(12)1-3-14(4-2-10)7-5-8(9(15)16)13-6-7/h7-8,13H,1-6H2,(H,15,16)
InChIKeySMOFNUHVDVQSOG-UHFFFAOYSA-N
MW234.25 g/mol
LogP0.53
Rot. Bonds2

About 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid

4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid (PubChem CID 146517489) has the molecular formula C10H16F2N2O2 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid
PubChem CID146517489
Molecular FormulaC10H16F2N2O2
Molecular Weight234.25 g/mol
Exact Mass234.12
IUPAC Name4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid
SMILESO=C(O)C1CC(N2CCC(F)(F)CC2)CN1
InChIInChI=1S/C10H16F2N2O2/c11-10(12)1-3-14(4-2-10)7-5-8(9(15)16)13-6-7/h7-8,13H,1-6H2,(H,15,16)
InChIKeySMOFNUHVDVQSOG-UHFFFAOYSA-N
XLogP0.53
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.25
LogP ≤ 50.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid (CID 146517489) is 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid is O=C(O)C1CC(N2CCC(F)(F)CC2)CN1.
What is the InChIKey of 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid?
The InChIKey is SMOFNUHVDVQSOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N2O2/c11-10(12)1-3-14(4-2-10)7-5-8(9(15)16)13-6-7/h7-8,13H,1-6H2,(H,15,16).
What are the key properties of 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid?
4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid has a molecular weight of 234.25 g/mol, XLogP of 0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluoropiperidin-1-yl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 146517489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).