C32H38F5N5O3 — CID 146517791
tert-butyl 3-[3,5-difluoro-4-[(6S,8R)-8-methyl-3-[(2S)-oxan-2-yl]-7-(2,2,2-trifluoroethyl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]anilino]azetidine-1-carboxylate (PubChem CID 146517791) has the molecular formula C32H38F5N5O3 and a molecular weight of 635.68 g/mol. Its IUPAC name is tert-butyl 3-[3,5-difluoro-4-[(6S,8R)-8-methyl-3-[(2S)-oxan-2-yl]-7-(2,2,2-trifluoroethyl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]anilino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3,5-difluoro-4-[(6S,8R)-8-methyl-3-[(2S)-oxan-2-yl]-7-(2,2,2-trifluoroethyl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]anilino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 146517791 |
| Molecular Formula | C32H38F5N5O3 |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | tert-butyl 3-[3,5-difluoro-4-[(6S,8R)-8-methyl-3-[(2S)-oxan-2-yl]-7-(2,2,2-trifluoroethyl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]anilino]azetidine-1-carboxylate |
| SMILES | C[C@@H]1Cc2c(ccc3c2cnn3[C@@H]2CCCCO2)[C@@H](c2c(F)cc(NC3CN(C(=O)OC(C)(C)C)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C32H38F5N5O3/c1-18-11-22-21(8-9-26-23(22)14-38-42(26)27-7-5-6-10-44-27)29(41(18)17-32(35,36)37)28-24(33)12-19(13-25(28)34)39-20-15-40(16-20)30(43)45-31(2,3)4/h8-9,12-14,18,20,27,29,39H,5-7,10-11,15-17H2,1-4H3/t18-,27+,29+/m1/s1 |
| InChIKey | SAHOIHAQBIIZIL-GBXPKZPQSA-N |
| XLogP | 6.94 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |