C25H20N6 — CID 146518290
6-(2-ethyl-1H-imidazol-5-yl)-11-(2-methyl-1H-imidazol-5-yl)phenanthro[9,10-b]pyrazine (PubChem CID 146518290) has the molecular formula C25H20N6 and a molecular weight of 404.48 g/mol. Its IUPAC name is 6-(2-ethyl-1H-imidazol-5-yl)-11-(2-methyl-1H-imidazol-5-yl)phenanthro[9,10-b]pyrazine.
| Compound Name | 6-(2-ethyl-1H-imidazol-5-yl)-11-(2-methyl-1H-imidazol-5-yl)phenanthro[9,10-b]pyrazine |
|---|---|
| PubChem CID | 146518290 |
| Molecular Formula | C25H20N6 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 6-(2-ethyl-1H-imidazol-5-yl)-11-(2-methyl-1H-imidazol-5-yl)phenanthro[9,10-b]pyrazine |
| SMILES | CCc1ncc(-c2ccc3c4ccc(-c5cnc(C)[nH]5)cc4c4nccnc4c3c2)[nH]1 |
| InChI | InChI=1S/C25H20N6/c1-3-23-29-13-22(31-23)16-5-7-18-17-6-4-15(21-12-28-14(2)30-21)10-19(17)24-25(20(18)11-16)27-9-8-26-24/h4-13H,3H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | VTCLHUNNGMFTBX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|