C25H20N4OS — CID 146518315
4-[5-(2-propan-2-yl-1H-imidazol-5-yl)phenanthro[10,9-b]furan-10-yl]-1,3-dihydroimidazole-2-thione (PubChem CID 146518315) has the molecular formula C25H20N4OS and a molecular weight of 424.53 g/mol. Its IUPAC name is 4-[5-(2-propan-2-yl-1H-imidazol-5-yl)phenanthro[10,9-b]furan-10-yl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[5-(2-propan-2-yl-1H-imidazol-5-yl)phenanthro[10,9-b]furan-10-yl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 146518315 |
| Molecular Formula | C25H20N4OS |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 4-[5-(2-propan-2-yl-1H-imidazol-5-yl)phenanthro[10,9-b]furan-10-yl]-1,3-dihydroimidazole-2-thione |
| SMILES | CC(C)c1ncc(-c2ccc3c(c2)c2ccoc2c2cc(-c4c[nH]c(=S)[nH]4)ccc32)[nH]1 |
| InChI | InChI=1S/C25H20N4OS/c1-13(2)24-26-11-21(28-24)14-3-5-16-17-6-4-15(22-12-27-25(31)29-22)10-20(17)23-18(7-8-30-23)19(16)9-14/h3-13H,1-2H3,(H,26,28)(H2,27,29,31) |
| InChIKey | PYRXOQDJWXGLBM-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|