C22H29BrF2N2O2 — CID 146518467
(1R,3R)-1-(4-bromo-2-methoxycyclohexa-2,4-dien-1-yl)-2-(2,2-difluoro-3-methoxypropyl)-3,5-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 146518467) has the molecular formula C22H29BrF2N2O2 and a molecular weight of 471.39 g/mol. Its IUPAC name is (1R,3R)-1-(4-bromo-2-methoxycyclohexa-2,4-dien-1-yl)-2-(2,2-difluoro-3-methoxypropyl)-3,5-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine.
| Compound Name | (1R,3R)-1-(4-bromo-2-methoxycyclohexa-2,4-dien-1-yl)-2-(2,2-difluoro-3-methoxypropyl)-3,5-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 146518467 |
| Molecular Formula | C22H29BrF2N2O2 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | (1R,3R)-1-(4-bromo-2-methoxycyclohexa-2,4-dien-1-yl)-2-(2,2-difluoro-3-methoxypropyl)-3,5-dimethyl-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | COCC(F)(F)CN1[C@H](C)Cc2c(ccc(N)c2C)[C@H]1C1CC=C(Br)C=C1OC |
| InChI | InChI=1S/C22H29BrF2N2O2/c1-13-9-18-14(2)19(26)8-7-16(18)21(27(13)11-22(24,25)12-28-3)17-6-5-15(23)10-20(17)29-4/h5,7-8,10,13,17,21H,6,9,11-12,26H2,1-4H3/t13-,17?,21+/m1/s1 |
| InChIKey | PUKNMMCELWDTBX-KVCBOLPTSA-N |
| XLogP | 4.98 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|