C20H23BrF2N4O — CID 146518471
(3R)-1-(5-bromo-2-pyridinyl)-2-(2,2-difluoro-3-methoxypropyl)-5-methanimidoyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 146518471) has the molecular formula C20H23BrF2N4O and a molecular weight of 453.33 g/mol. Its IUPAC name is (3R)-1-(5-bromo-2-pyridinyl)-2-(2,2-difluoro-3-methoxypropyl)-5-methanimidoyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-amine.
| Compound Name | (3R)-1-(5-bromo-2-pyridinyl)-2-(2,2-difluoro-3-methoxypropyl)-5-methanimidoyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 146518471 |
| Molecular Formula | C20H23BrF2N4O |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (3R)-1-(5-bromo-2-pyridinyl)-2-(2,2-difluoro-3-methoxypropyl)-5-methanimidoyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | [H]/N=C/c1c(N)ccc2c1C[C@@H](C)N(CC(F)(F)COC)C2c1ccc(Br)cn1 |
| InChI | InChI=1S/C20H23BrF2N4O/c1-12-7-15-14(4-5-17(25)16(15)8-24)19(18-6-3-13(21)9-26-18)27(12)10-20(22,23)11-28-2/h3-6,8-9,12,19,24H,7,10-11,25H2,1-2H3/b24-8+/t12-,19?/m1/s1 |
| InChIKey | WEUXZWZRQHHHMM-TXROMYMQSA-N |
| XLogP | 4.04 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|