C11H19N3O — CID 146518501
6-amino-N',N',6-trimethylcyclohepta-2,4-diene-1-carbohydrazide (PubChem CID 146518501) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 6-amino-N',N',6-trimethylcyclohepta-2,4-diene-1-carbohydrazide.
| Compound Name | 6-amino-N',N',6-trimethylcyclohepta-2,4-diene-1-carbohydrazide |
|---|---|
| PubChem CID | 146518501 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 6-amino-N',N',6-trimethylcyclohepta-2,4-diene-1-carbohydrazide |
| SMILES | CN(C)NC(=O)C1C=CC=CC(C)(N)C1 |
| InChI | InChI=1S/C11H19N3O/c1-11(12)7-5-4-6-9(8-11)10(15)13-14(2)3/h4-7,9H,8,12H2,1-3H3,(H,13,15) |
| InChIKey | AQASEMDJEQFESM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|