C22H25FN8S — CID 146519308
6-[6-fluoro-4-(4-methylsulfanylpiperazin-1-yl)-2-pyridinyl]-5-methyl-2-pyrimidin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 146519308) has the molecular formula C22H25FN8S and a molecular weight of 452.56 g/mol. Its IUPAC name is 6-[6-fluoro-4-(4-methylsulfanylpiperazin-1-yl)-2-pyridinyl]-5-methyl-2-pyrimidin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[6-fluoro-4-(4-methylsulfanylpiperazin-1-yl)-2-pyridinyl]-5-methyl-2-pyrimidin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 146519308 |
| Molecular Formula | C22H25FN8S |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 6-[6-fluoro-4-(4-methylsulfanylpiperazin-1-yl)-2-pyridinyl]-5-methyl-2-pyrimidin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | CSN1CCN(c2cc(F)nc(N3CCc4nc(-c5ncccn5)ncc4C3C)c2)CC1 |
| InChI | InChI=1S/C22H25FN8S/c1-15-17-14-26-22(21-24-5-3-6-25-21)27-18(17)4-7-31(15)20-13-16(12-19(23)28-20)29-8-10-30(32-2)11-9-29/h3,5-6,12-15H,4,7-11H2,1-2H3 |
| InChIKey | IETILRNBCOBLHU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 74.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|