C52H32N4O — CID 146519499
(13S)-2'-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]spiro[1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene-13,9'-xanthene] (PubChem CID 146519499) has the molecular formula C52H32N4O and a molecular weight of 728.86 g/mol. Its IUPAC name is (13S)-2'-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]spiro[1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene-13,9'-xanthene].
| Compound Name | (13S)-2'-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]spiro[1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene-13,9'-xanthene] |
|---|---|
| PubChem CID | 146519499 |
| Molecular Formula | C52H32N4O |
| Molecular Weight | 728.86 g/mol |
| Exact Mass | 728.26 |
| IUPAC Name | (13S)-2'-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]spiro[1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene-13,9'-xanthene] |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)[C@@]4(c6ccccc6O5)c5ccccc5-n5c6ccccc6c6cccc4c65)cc3)n2)cc1 |
| InChI | InChI=1S/C52H32N4O/c1-3-14-34(15-4-1)49-53-50(35-16-5-2-6-17-35)55-51(54-49)36-28-26-33(27-29-36)37-30-31-47-43(32-37)52(41-21-9-12-25-46(41)57-47)40-20-8-11-24-45(40)56-44-23-10-7-18-38(44)39-19-13-22-42(52)48(39)56/h1-32H/t52-/m1/s1 |
| InChIKey | WHEXRTSDHMDPEI-OIVUAWODSA-N |
| XLogP | 12.44 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.86 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |