C55H38F3N3 — CID 146519828
3,5-bis[3-(2-methylphenyl)carbazol-9-yl]-4-[2-prop-1-en-2-yl-5-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 146519828) has the molecular formula C55H38F3N3 and a molecular weight of 797.92 g/mol. Its IUPAC name is 3,5-bis[3-(2-methylphenyl)carbazol-9-yl]-4-[2-prop-1-en-2-yl-5-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis[3-(2-methylphenyl)carbazol-9-yl]-4-[2-prop-1-en-2-yl-5-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 146519828 |
| Molecular Formula | C55H38F3N3 |
| Molecular Weight | 797.92 g/mol |
| Exact Mass | 797.30 |
| IUPAC Name | 3,5-bis[3-(2-methylphenyl)carbazol-9-yl]-4-[2-prop-1-en-2-yl-5-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | C=C(C)c1ccc(C(F)(F)F)cc1-c1c(-n2c3ccccc3c3cc(-c4ccccc4C)ccc32)cc(C#N)cc1-n1c2ccccc2c2cc(-c3ccccc3C)ccc21 |
| InChI | InChI=1S/C55H38F3N3/c1-33(2)40-24-23-39(55(56,57)58)31-47(40)54-52(60-48-19-11-9-17-43(48)45-29-37(21-25-50(45)60)41-15-7-5-13-34(41)3)27-36(32-59)28-53(54)61-49-20-12-10-18-44(49)46-30-38(22-26-51(46)61)42-16-8-6-14-35(42)4/h5-31H,1H2,2-4H3 |
| InChIKey | LKOTYONFSBMCNX-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.92 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |