C22H22Cl3NO5S — CID 146520288
2-[[4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]phenoxy]methyl]-4-methylsulfonyl-1,3-oxazole (PubChem CID 146520288) has the molecular formula C22H22Cl3NO5S and a molecular weight of 518.85 g/mol. Its IUPAC name is 2-[[4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]phenoxy]methyl]-4-methylsulfonyl-1,3-oxazole.
| Compound Name | 2-[[4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]phenoxy]methyl]-4-methylsulfonyl-1,3-oxazole |
|---|---|
| PubChem CID | 146520288 |
| Molecular Formula | C22H22Cl3NO5S |
| Molecular Weight | 518.85 g/mol |
| Exact Mass | 517.03 |
| IUPAC Name | 2-[[4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]phenoxy]methyl]-4-methylsulfonyl-1,3-oxazole |
| SMILES | CC(C)(c1ccc(OCc2nc(S(C)(=O)=O)co2)cc1)c1cc(Cl)c(OCCCl)c(Cl)c1 |
| InChI | InChI=1S/C22H22Cl3NO5S/c1-22(2,15-10-17(24)21(18(25)11-15)29-9-8-23)14-4-6-16(7-5-14)30-12-19-26-20(13-31-19)32(3,27)28/h4-7,10-11,13H,8-9,12H2,1-3H3 |
| InChIKey | YXZSPZWSYXZSBK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.85 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|