C18H18F2N2O3S — CID 146520586
N-[2-[3,5-difluoro-4-(2-oxopiperidin-1-yl)phenyl]phenyl]methanesulfonamide (PubChem CID 146520586) has the molecular formula C18H18F2N2O3S and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[2-[3,5-difluoro-4-(2-oxopiperidin-1-yl)phenyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[3,5-difluoro-4-(2-oxopiperidin-1-yl)phenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 146520586 |
| Molecular Formula | C18H18F2N2O3S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[2-[3,5-difluoro-4-(2-oxopiperidin-1-yl)phenyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1-c1cc(F)c(N2CCCCC2=O)c(F)c1 |
| InChI | InChI=1S/C18H18F2N2O3S/c1-26(24,25)21-16-7-3-2-6-13(16)12-10-14(19)18(15(20)11-12)22-9-5-4-8-17(22)23/h2-3,6-7,10-11,21H,4-5,8-9H2,1H3 |
| InChIKey | MAMFTGDITOEDMI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |