C22H23Cl3N2O5S — CID 146520818
N-[5-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-1,3-oxazol-4-yl]methanesulfonamide (PubChem CID 146520818) has the molecular formula C22H23Cl3N2O5S and a molecular weight of 533.86 g/mol. Its IUPAC name is N-[5-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-1,3-oxazol-4-yl]methanesulfonamide.
| Compound Name | N-[5-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-1,3-oxazol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 146520818 |
| Molecular Formula | C22H23Cl3N2O5S |
| Molecular Weight | 533.86 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | N-[5-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-1,3-oxazol-4-yl]methanesulfonamide |
| SMILES | CC(C)(c1ccc(Oc2ocnc2NS(C)(=O)=O)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl3N2O5S/c1-22(2,15-11-17(24)19(18(25)12-15)30-10-4-9-23)14-5-7-16(8-6-14)32-21-20(26-13-31-21)27-33(3,28)29/h5-8,11-13,27H,4,9-10H2,1-3H3 |
| InChIKey | YGCPSPXCJHGKEJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.86 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|