About 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid
4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid (PubChem CID 146520850) has the molecular formula C19H13Cl2O5P
and a molecular weight of 423.19 g/mol. Its IUPAC name is 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid.
Molecular Properties
| Compound Name | 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid |
| PubChem CID | 146520850 |
| Molecular Formula | C19H13Cl2O5P |
| Molecular Weight | 423.19 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid |
| SMILES | CCOP(=O)(C#Cc1cc(Cl)c(C(=O)O)c(Cl)c1)c1ccc2ccoc2c1 |
| InChI | InChI=1S/C19H13Cl2O5P/c1-2-26-27(24,14-4-3-13-5-7-25-17(13)11-14)8-6-12-9-15(20)18(19(22)23)16(21)10-12/h3-5,7,9-11H,2H2,1H3,(H,22,23) |
| InChIKey | GSMHPUAVJPOSAH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.19 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid?
The IUPAC name of 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid (CID 146520850) is 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid.
What is the SMILES notation for 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid?
The canonical SMILES for 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid is CCOP(=O)(C#Cc1cc(Cl)c(C(=O)O)c(Cl)c1)c1ccc2ccoc2c1.
What is the InChIKey of 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid?
The InChIKey is GSMHPUAVJPOSAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2O5P/c1-2-26-27(24,14-4-3-13-5-7-25-17(13)11-14)8-6-12-9-15(20)18(19(22)23)16(21)10-12/h3-5,7,9-11H,2H2,1H3,(H,22,23).
What are the key properties of 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid?
4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid has a molecular weight of 423.19 g/mol, XLogP of 5.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[1-benzofuran-6-yl(ethoxy)phosphoryl]ethynyl]-2,6-dichlorobenzoic acid is sourced from PubChem (CID 146520850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).