About 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid
2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid (PubChem CID 146521317) has the molecular formula C9H9BrN2O5
and a molecular weight of 305.08 g/mol. Its IUPAC name is 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid |
| PubChem CID | 146521317 |
| Molecular Formula | C9H9BrN2O5 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid |
| SMILES | CC(C=O)n1c(=O)c(Br)cn(CC(=O)O)c1=O |
| InChI | InChI=1S/C9H9BrN2O5/c1-5(4-13)12-8(16)6(10)2-11(9(12)17)3-7(14)15/h2,4-5H,3H2,1H3,(H,14,15) |
| InChIKey | IIBOHTIGOGHVNW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid?
The IUPAC name of 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid (CID 146521317) is 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid.
What is the SMILES notation for 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid?
The canonical SMILES for 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid is CC(C=O)n1c(=O)c(Br)cn(CC(=O)O)c1=O.
What is the InChIKey of 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid?
The InChIKey is IIBOHTIGOGHVNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O5/c1-5(4-13)12-8(16)6(10)2-11(9(12)17)3-7(14)15/h2,4-5H,3H2,1H3,(H,14,15).
What are the key properties of 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid?
2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid has a molecular weight of 305.08 g/mol, XLogP of -0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-bromo-2,4-dioxo-3-(1-oxopropan-2-yl)pyrimidin-1-yl]acetic acid is sourced from PubChem (CID 146521317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).