C6H3FOS2 — CID 146521378
3-fluorothieno[3,4-b]thiophen-6-ol (PubChem CID 146521378) has the molecular formula C6H3FOS2 and a molecular weight of 174.22 g/mol. Its IUPAC name is 3-fluorothieno[3,4-b]thiophen-6-ol.
| Compound Name | 3-fluorothieno[3,4-b]thiophen-6-ol |
|---|---|
| PubChem CID | 146521378 |
| Molecular Formula | C6H3FOS2 |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 173.96 |
| IUPAC Name | 3-fluorothieno[3,4-b]thiophen-6-ol |
| SMILES | Oc1scc2c(F)csc12 |
| InChI | InChI=1S/C6H3FOS2/c7-4-2-9-5-3(4)1-10-6(5)8/h1-2,8H |
| InChIKey | JYKKEVWUDLUTMQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |