C14H18N2 — CID 146521452
4-(4-methylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-diene-1-carboximidamide (PubChem CID 146521452) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-(4-methylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-diene-1-carboximidamide.
| Compound Name | 4-(4-methylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 146521452 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 4-(4-methylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1C=CC(C2C=CC(C)=CC2)=CC1 |
| InChI | InChI=1S/C14H18N2/c1-10-2-4-11(5-3-10)12-6-8-13(9-7-12)14(15)16/h2-4,6-8,11,13H,5,9H2,1H3,(H3,15,16) |
| InChIKey | CWQHBSYMNBCGMS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|